C10H18N4O3 — CID 70141335
1,6-diamino-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4H-pyrimidin-2-one (PubChem CID 70141335) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1,6-diamino-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4H-pyrimidin-2-one.
| Compound Name | 1,6-diamino-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4H-pyrimidin-2-one |
|---|---|
| PubChem CID | 70141335 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1,6-diamino-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4H-pyrimidin-2-one |
| SMILES | CC1=C(N)N(N)C(=O)N([C@H]2CC[C@@H](CO)O2)C1 |
| InChI | InChI=1S/C10H18N4O3/c1-6-4-13(10(16)14(12)9(6)11)8-3-2-7(5-15)17-8/h7-8,15H,2-5,11-12H2,1H3/t7-,8+/m0/s1 |
| InChIKey | BTPGMWQOIGDSOE-JGVFFNPUSA-N |
| XLogP | -0.71 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|