C13H19N5O4 — CID 123415250
2-(2-amino-6-methoxy-8-methylpurin-9-yl)-5-(hydroxymethyl)-3-methyloxolan-3-ol (PubChem CID 123415250) has the molecular formula C13H19N5O4 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-(2-amino-6-methoxy-8-methylpurin-9-yl)-5-(hydroxymethyl)-3-methyloxolan-3-ol.
| Compound Name | 2-(2-amino-6-methoxy-8-methylpurin-9-yl)-5-(hydroxymethyl)-3-methyloxolan-3-ol |
|---|---|
| PubChem CID | 123415250 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-(2-amino-6-methoxy-8-methylpurin-9-yl)-5-(hydroxymethyl)-3-methyloxolan-3-ol |
| SMILES | COc1nc(N)nc2c1nc(C)n2C1OC(CO)CC1(C)O |
| InChI | InChI=1S/C13H19N5O4/c1-6-15-8-9(16-12(14)17-10(8)21-3)18(6)11-13(2,20)4-7(5-19)22-11/h7,11,19-20H,4-5H2,1-3H3,(H2,14,16,17) |
| InChIKey | SLSISVFIHPPOIK-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |