C13H17IN4O5 — CID 90163784
(3R,4R,5R)-5-(hydroxymethyl)-2-(8-iodo-6-methoxy-2-methylpurin-9-yl)-3-methyloxolane-3,4-diol (PubChem CID 90163784) has the molecular formula C13H17IN4O5 and a molecular weight of 436.21 g/mol. Its IUPAC name is (3R,4R,5R)-5-(hydroxymethyl)-2-(8-iodo-6-methoxy-2-methylpurin-9-yl)-3-methyloxolane-3,4-diol.
| Compound Name | (3R,4R,5R)-5-(hydroxymethyl)-2-(8-iodo-6-methoxy-2-methylpurin-9-yl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 90163784 |
| Molecular Formula | C13H17IN4O5 |
| Molecular Weight | 436.21 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | (3R,4R,5R)-5-(hydroxymethyl)-2-(8-iodo-6-methoxy-2-methylpurin-9-yl)-3-methyloxolane-3,4-diol |
| SMILES | COc1nc(C)nc2c1nc(I)n2C1O[C@H](CO)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C13H17IN4O5/c1-5-15-9-7(10(16-5)22-3)17-12(14)18(9)11-13(2,21)8(20)6(4-19)23-11/h6,8,11,19-21H,4H2,1-3H3/t6-,8-,11?,13-/m1/s1 |
| InChIKey | XYUIPWPHUQEEBT-USXOJEKESA-N |
| XLogP | -0.25 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.21 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|