C15H19N5O4 — CID 70960465
(4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6-methyl-3,5,7,9,12-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-3-yl)oxolane-3,4-diol (PubChem CID 70960465) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is (4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6-methyl-3,5,7,9,12-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-3-yl)oxolane-3,4-diol.
| Compound Name | (4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6-methyl-3,5,7,9,12-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-3-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70960465 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (4R,5R)-5-(hydroxymethyl)-3-methyl-2-(6-methyl-3,5,7,9,12-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-3-yl)oxolane-3,4-diol |
| SMILES | Cc1nc2c3c(cn(C4O[C@H](CO)[C@@H](O)C4(C)O)c3n1)N=CCN2 |
| InChI | InChI=1S/C15H19N5O4/c1-7-18-12-10-8(16-3-4-17-12)5-20(13(10)19-7)14-15(2,23)11(22)9(6-21)24-14/h3,5,9,11,14,21-23H,4,6H2,1-2H3,(H,17,18,19)/t9-,11-,14?,15?/m1/s1 |
| InChIKey | WPLNSZAAMUQTQW-SZUCHGLFSA-N |
| XLogP | -0.13 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |