C15H17ClN4O4 — CID 143012539
(3R,4R,5R)-2-(6-chloro-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-3-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (PubChem CID 143012539) has the molecular formula C15H17ClN4O4 and a molecular weight of 352.78 g/mol. Its IUPAC name is (3R,4R,5R)-2-(6-chloro-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-3-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol.
| Compound Name | (3R,4R,5R)-2-(6-chloro-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-3-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 143012539 |
| Molecular Formula | C15H17ClN4O4 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (3R,4R,5R)-2-(6-chloro-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-3-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| SMILES | C[C@]1(O)C(n2cc3c4c(nc(Cl)nc42)NCC=C3)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C15H17ClN4O4/c1-15(23)10(22)8(6-21)24-13(15)20-5-7-3-2-4-17-11-9(7)12(20)19-14(16)18-11/h2-3,5,8,10,13,21-23H,4,6H2,1H3,(H,17,18,19)/t8-,10-,13?,15-/m1/s1 |
| InChIKey | VSKIUMUIUDTRHD-LCRJYUOVSA-N |
| XLogP | 0.52 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |