C14H17N5O4 — CID 90982061
(2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(3,5,7,9,10-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),9-pentaen-3-yl)oxolane-3,4-diol (PubChem CID 90982061) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(3,5,7,9,10-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),9-pentaen-3-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(3,5,7,9,10-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),9-pentaen-3-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 90982061 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (2R,3R,4R,5R)-5-(hydroxymethyl)-3-methyl-2-(3,5,7,9,10-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),9-pentaen-3-yl)oxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cc2c3c(ncnc31)N=NCC2 |
| InChI | InChI=1S/C14H17N5O4/c1-14(22)10(21)8(5-20)23-13(14)19-4-7-2-3-17-18-11-9(7)12(19)16-6-15-11/h4,6,8,10,13,20-22H,2-3,5H2,1H3/t8-,10-,13-,14-/m1/s1 |
| InChIKey | CIWODDMAJNEDFZ-KNJXUWEQSA-N |
| XLogP | 0.07 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |