C15H21N5O4 — CID 143018208
2-amino-6-ethoxy-9-[5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enylpurin-8-one (PubChem CID 143018208) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-amino-6-ethoxy-9-[5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enylpurin-8-one.
| Compound Name | 2-amino-6-ethoxy-9-[5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enylpurin-8-one |
|---|---|
| PubChem CID | 143018208 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-amino-6-ethoxy-9-[5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enylpurin-8-one |
| SMILES | C=CCn1c(=O)n(C2CCC(CO)O2)c2nc(N)nc(OCC)c21 |
| InChI | InChI=1S/C15H21N5O4/c1-3-7-19-11-12(17-14(16)18-13(11)23-4-2)20(15(19)22)10-6-5-9(8-21)24-10/h3,9-10,21H,1,4-8H2,2H3,(H2,16,17,18) |
| InChIKey | WAOWUBCQHWWRSS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|