C25H42N6O5Si — CID 58076094
N-[[2-amino-9-[(2R,4R,5R)-5-ethyl-4-methyl-3-triethylsilyloxyoxolan-2-yl]-8-oxo-7-prop-2-enylpurin-6-yl]oxymethyl]-N-methylacetamide (PubChem CID 58076094) has the molecular formula C25H42N6O5Si and a molecular weight of 534.73 g/mol. Its IUPAC name is N-[[2-amino-9-[(2R,4R,5R)-5-ethyl-4-methyl-3-triethylsilyloxyoxolan-2-yl]-8-oxo-7-prop-2-enylpurin-6-yl]oxymethyl]-N-methylacetamide.
| Compound Name | N-[[2-amino-9-[(2R,4R,5R)-5-ethyl-4-methyl-3-triethylsilyloxyoxolan-2-yl]-8-oxo-7-prop-2-enylpurin-6-yl]oxymethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 58076094 |
| Molecular Formula | C25H42N6O5Si |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | N-[[2-amino-9-[(2R,4R,5R)-5-ethyl-4-methyl-3-triethylsilyloxyoxolan-2-yl]-8-oxo-7-prop-2-enylpurin-6-yl]oxymethyl]-N-methylacetamide |
| SMILES | C=CCn1c(=O)n([C@@H]2O[C@H](CC)[C@@H](C)C2O[Si](CC)(CC)CC)c2nc(N)nc(OCN(C)C(C)=O)c21 |
| InChI | InChI=1S/C25H42N6O5Si/c1-9-14-30-19-21(27-24(26)28-22(19)34-15-29(8)17(7)32)31(25(30)33)23-20(16(6)18(10-2)35-23)36-37(11-3,12-4)13-5/h9,16,18,20,23H,1,10-15H2,2-8H3,(H2,26,27,28)/t16-,18-,20?,23-/m1/s1 |
| InChIKey | GCMJYUWVKIADJO-OXEHACBSSA-N |
| XLogP | 3.51 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|