C7H9N4O5PS — CID 136620644
2-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)ethylphosphonic acid (PubChem CID 136620644) has the molecular formula C7H9N4O5PS and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)ethylphosphonic acid.
| Compound Name | 2-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)ethylphosphonic acid |
|---|---|
| PubChem CID | 136620644 |
| Molecular Formula | C7H9N4O5PS |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 2-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)ethylphosphonic acid |
| SMILES | Nc1nc2c(sc(=O)n2CCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C7H9N4O5PS/c8-6-9-4-3(5(12)10-6)18-7(13)11(4)1-2-17(14,15)16/h1-2H2,(H2,14,15,16)(H3,8,9,10,12) |
| InChIKey | BHAXVWBYWXGHBD-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|