C21H24FNO3 — CID 164526849
benzyl (2R)-3-[(3-ethyl-5-fluoro-4-methylbenzoyl)amino]-2-methylpropanoate (PubChem CID 164526849) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is benzyl (2R)-3-[(3-ethyl-5-fluoro-4-methylbenzoyl)amino]-2-methylpropanoate.
| Compound Name | benzyl (2R)-3-[(3-ethyl-5-fluoro-4-methylbenzoyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 164526849 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | benzyl (2R)-3-[(3-ethyl-5-fluoro-4-methylbenzoyl)amino]-2-methylpropanoate |
| SMILES | CCc1cc(C(=O)NC[C@@H](C)C(=O)OCc2ccccc2)cc(F)c1C |
| InChI | InChI=1S/C21H24FNO3/c1-4-17-10-18(11-19(22)15(17)3)20(24)23-12-14(2)21(25)26-13-16-8-6-5-7-9-16/h5-11,14H,4,12-13H2,1-3H3,(H,23,24)/t14-/m1/s1 |
| InChIKey | JCGCHFUROUJWEC-CQSZACIVSA-N |
| XLogP | 3.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |