C25H24FNO3 — CID 164526971
benzyl 3-[[3-(2-ethylphenyl)-5-fluorobenzoyl]amino]propanoate (PubChem CID 164526971) has the molecular formula C25H24FNO3 and a molecular weight of 405.47 g/mol. Its IUPAC name is benzyl 3-[[3-(2-ethylphenyl)-5-fluorobenzoyl]amino]propanoate.
| Compound Name | benzyl 3-[[3-(2-ethylphenyl)-5-fluorobenzoyl]amino]propanoate |
|---|---|
| PubChem CID | 164526971 |
| Molecular Formula | C25H24FNO3 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | benzyl 3-[[3-(2-ethylphenyl)-5-fluorobenzoyl]amino]propanoate |
| SMILES | CCc1ccccc1-c1cc(F)cc(C(=O)NCCC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H24FNO3/c1-2-19-10-6-7-11-23(19)20-14-21(16-22(26)15-20)25(29)27-13-12-24(28)30-17-18-8-4-3-5-9-18/h3-11,14-16H,2,12-13,17H2,1H3,(H,27,29) |
| InChIKey | SRNMRPNKVIEWNP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |