C18H19FN2O3 — CID 164526841
(2R)-2-amino-3-[[3-(2-ethylphenyl)-5-fluorobenzoyl]amino]propanoic acid (PubChem CID 164526841) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is (2R)-2-amino-3-[[3-(2-ethylphenyl)-5-fluorobenzoyl]amino]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[3-(2-ethylphenyl)-5-fluorobenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 164526841 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (2R)-2-amino-3-[[3-(2-ethylphenyl)-5-fluorobenzoyl]amino]propanoic acid |
| SMILES | CCc1ccccc1-c1cc(F)cc(C(=O)NC[C@@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C18H19FN2O3/c1-2-11-5-3-4-6-15(11)12-7-13(9-14(19)8-12)17(22)21-10-16(20)18(23)24/h3-9,16H,2,10,20H2,1H3,(H,21,22)(H,23,24)/t16-/m1/s1 |
| InChIKey | MVZWFFGETHELPF-MRXNPFEDSA-N |
| XLogP | 2.20 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |