C17H16FN3O4 — CID 164527255
2-amino-3-[[3-(2-carbamoylphenyl)-5-fluorobenzoyl]amino]propanoic acid (PubChem CID 164527255) has the molecular formula C17H16FN3O4 and a molecular weight of 345.33 g/mol. Its IUPAC name is 2-amino-3-[[3-(2-carbamoylphenyl)-5-fluorobenzoyl]amino]propanoic acid.
| Compound Name | 2-amino-3-[[3-(2-carbamoylphenyl)-5-fluorobenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 164527255 |
| Molecular Formula | C17H16FN3O4 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-amino-3-[[3-(2-carbamoylphenyl)-5-fluorobenzoyl]amino]propanoic acid |
| SMILES | NC(=O)c1ccccc1-c1cc(F)cc(C(=O)NCC(N)C(=O)O)c1 |
| InChI | InChI=1S/C17H16FN3O4/c18-11-6-9(12-3-1-2-4-13(12)15(20)22)5-10(7-11)16(23)21-8-14(19)17(24)25/h1-7,14H,8,19H2,(H2,20,22)(H,21,23)(H,24,25) |
| InChIKey | QRVDRCUAKAZDBI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |