C15H17FN4O3 — CID 164527008
2-amino-3-[[3-(3-ethylimidazol-4-yl)-5-fluorobenzoyl]amino]propanoic acid (PubChem CID 164527008) has the molecular formula C15H17FN4O3 and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-amino-3-[[3-(3-ethylimidazol-4-yl)-5-fluorobenzoyl]amino]propanoic acid.
| Compound Name | 2-amino-3-[[3-(3-ethylimidazol-4-yl)-5-fluorobenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 164527008 |
| Molecular Formula | C15H17FN4O3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-amino-3-[[3-(3-ethylimidazol-4-yl)-5-fluorobenzoyl]amino]propanoic acid |
| SMILES | CCn1cncc1-c1cc(F)cc(C(=O)NCC(N)C(=O)O)c1 |
| InChI | InChI=1S/C15H17FN4O3/c1-2-20-8-18-7-13(20)9-3-10(5-11(16)4-9)14(21)19-6-12(17)15(22)23/h3-5,7-8,12H,2,6,17H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | IFZGSISPAUUKOZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |