C21H20ClFN4O3 — CID 167117374
phenyl 2-amino-3-[[3-(4-chloro-1-ethylpyrazol-5-yl)-5-fluorobenzoyl]amino]propanoate (PubChem CID 167117374) has the molecular formula C21H20ClFN4O3 and a molecular weight of 430.87 g/mol. Its IUPAC name is phenyl 2-amino-3-[[3-(4-chloro-1-ethylpyrazol-5-yl)-5-fluorobenzoyl]amino]propanoate.
| Compound Name | phenyl 2-amino-3-[[3-(4-chloro-1-ethylpyrazol-5-yl)-5-fluorobenzoyl]amino]propanoate |
|---|---|
| PubChem CID | 167117374 |
| Molecular Formula | C21H20ClFN4O3 |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | phenyl 2-amino-3-[[3-(4-chloro-1-ethylpyrazol-5-yl)-5-fluorobenzoyl]amino]propanoate |
| SMILES | CCn1ncc(Cl)c1-c1cc(F)cc(C(=O)NCC(N)C(=O)Oc2ccccc2)c1 |
| InChI | InChI=1S/C21H20ClFN4O3/c1-2-27-19(17(22)11-26-27)13-8-14(10-15(23)9-13)20(28)25-12-18(24)21(29)30-16-6-4-3-5-7-16/h3-11,18H,2,12,24H2,1H3,(H,25,28) |
| InChIKey | XZRAGLHXCWWHIP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|