C23H25FN4O3 — CID 164527780
benzyl 3-[[3-(3-tert-butyltriazol-4-yl)-5-fluorobenzoyl]amino]propanoate (PubChem CID 164527780) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is benzyl 3-[[3-(3-tert-butyltriazol-4-yl)-5-fluorobenzoyl]amino]propanoate.
| Compound Name | benzyl 3-[[3-(3-tert-butyltriazol-4-yl)-5-fluorobenzoyl]amino]propanoate |
|---|---|
| PubChem CID | 164527780 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | benzyl 3-[[3-(3-tert-butyltriazol-4-yl)-5-fluorobenzoyl]amino]propanoate |
| SMILES | CC(C)(C)n1nncc1-c1cc(F)cc(C(=O)NCCC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H25FN4O3/c1-23(2,3)28-20(14-26-27-28)17-11-18(13-19(24)12-17)22(30)25-10-9-21(29)31-15-16-7-5-4-6-8-16/h4-8,11-14H,9-10,15H2,1-3H3,(H,25,30) |
| InChIKey | WZVZSZAYGKQEOR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |