C38H23N5 — CID 164528261
10-(2,4,6-triphenylpyrimidin-5-yl)-1,4,16-triazapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene (PubChem CID 164528261) has the molecular formula C38H23N5 and a molecular weight of 549.64 g/mol. Its IUPAC name is 10-(2,4,6-triphenylpyrimidin-5-yl)-1,4,16-triazapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene.
| Compound Name | 10-(2,4,6-triphenylpyrimidin-5-yl)-1,4,16-triazapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene |
|---|---|
| PubChem CID | 164528261 |
| Molecular Formula | C38H23N5 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 10-(2,4,6-triphenylpyrimidin-5-yl)-1,4,16-triazapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13(18),14,16-nonaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)c(-c3cc4c5ccncc5n5c6cnccc6c(c3)c45)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C38H23N5/c1-4-10-24(11-5-1)35-34(36(25-12-6-2-7-13-25)42-38(41-35)26-14-8-3-9-15-26)27-20-30-28-16-18-39-22-32(28)43-33-23-40-19-17-29(33)31(21-27)37(30)43/h1-23H |
| InChIKey | SEGWCFPVLWMNBT-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |