C11H10ClF3N6O2 — CID 164529259
3-amino-2-chloro-N-(1-ethyltetrazol-5-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 164529259) has the molecular formula C11H10ClF3N6O2 and a molecular weight of 350.69 g/mol. Its IUPAC name is 3-amino-2-chloro-N-(1-ethyltetrazol-5-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | 3-amino-2-chloro-N-(1-ethyltetrazol-5-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 164529259 |
| Molecular Formula | C11H10ClF3N6O2 |
| Molecular Weight | 350.69 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 3-amino-2-chloro-N-(1-ethyltetrazol-5-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | CCn1nnnc1NC(=O)c1ccc(OC(F)(F)F)c(N)c1Cl |
| InChI | InChI=1S/C11H10ClF3N6O2/c1-2-21-10(18-19-20-21)17-9(22)5-3-4-6(8(16)7(5)12)23-11(13,14)15/h3-4H,2,16H2,1H3,(H,17,18,20,22) |
| InChIKey | CJYCKNAKPAVVAL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|