C13H13N5OS — CID 161497262
N-(1-ethyltetrazol-5-yl)-7-methyl-1-benzothiophene-6-carboxamide (PubChem CID 161497262) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is N-(1-ethyltetrazol-5-yl)-7-methyl-1-benzothiophene-6-carboxamide.
| Compound Name | N-(1-ethyltetrazol-5-yl)-7-methyl-1-benzothiophene-6-carboxamide |
|---|---|
| PubChem CID | 161497262 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-(1-ethyltetrazol-5-yl)-7-methyl-1-benzothiophene-6-carboxamide |
| SMILES | CCn1nnnc1NC(=O)c1ccc2ccsc2c1C |
| InChI | InChI=1S/C13H13N5OS/c1-3-18-13(15-16-17-18)14-12(19)10-5-4-9-6-7-20-11(9)8(10)2/h4-7H,3H2,1-2H3,(H,14,15,17,19) |
| InChIKey | IFDGNDZWSLYRIN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |