C12H15N5O3 — CID 957991
N-(1-ethyltetrazol-5-yl)-3,5-dimethoxybenzamide (PubChem CID 957991) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(1-ethyltetrazol-5-yl)-3,5-dimethoxybenzamide.
| Compound Name | N-(1-ethyltetrazol-5-yl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 957991 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(1-ethyltetrazol-5-yl)-3,5-dimethoxybenzamide |
| SMILES | CCn1nnnc1NC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C12H15N5O3/c1-4-17-12(14-15-16-17)13-11(18)8-5-9(19-2)7-10(6-8)20-3/h5-7H,4H2,1-3H3,(H,13,14,16,18) |
| InChIKey | LWLGOOITXZGKQC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |