C15H25N3O2S — CID 164529445
4-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]-1-morpholin-4-ylbutan-1-one (PubChem CID 164529445) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 4-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]-1-morpholin-4-ylbutan-1-one.
| Compound Name | 4-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]-1-morpholin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 164529445 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 4-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]-1-morpholin-4-ylbutan-1-one |
| SMILES | O=C(CCCSC1=N[C@H]2CCCC[C@@H]2N1)N1CCOCC1 |
| InChI | InChI=1S/C15H25N3O2S/c19-14(18-7-9-20-10-8-18)6-3-11-21-15-16-12-4-1-2-5-13(12)17-15/h12-13H,1-11H2,(H,16,17)/t12-,13-/m0/s1 |
| InChIKey | IIPZMGJLWQNVJM-STQMWFEESA-N |
| XLogP | 1.63 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|