C17H28N4OS — CID 164529450
2-methylprop-1-ene;1-piperazin-1-yl-2-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylsulfanyl)ethanone (PubChem CID 164529450) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is 2-methylprop-1-ene;1-piperazin-1-yl-2-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylsulfanyl)ethanone.
| Compound Name | 2-methylprop-1-ene;1-piperazin-1-yl-2-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 164529450 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-methylprop-1-ene;1-piperazin-1-yl-2-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylsulfanyl)ethanone |
| SMILES | C=C(C)C.O=C(CSc1nc2c([nH]1)CCCC2)N1CCNCC1 |
| InChI | InChI=1S/C13H20N4OS.C4H8/c18-12(17-7-5-14-6-8-17)9-19-13-15-10-3-1-2-4-11(10)16-13;1-4(2)3/h14H,1-9H2,(H,15,16);1H2,2-3H3 |
| InChIKey | DRZVKWFCOGMWBU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|