C13H20N4O2S — CID 164529475
4-[2-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]acetyl]piperazin-2-one (PubChem CID 164529475) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is 4-[2-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]acetyl]piperazin-2-one.
| Compound Name | 4-[2-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 164529475 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-[2-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]acetyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)CSC2=N[C@H]3CCCC[C@@H]3N2)CCN1 |
| InChI | InChI=1S/C13H20N4O2S/c18-11-7-17(6-5-14-11)12(19)8-20-13-15-9-3-1-2-4-10(9)16-13/h9-10H,1-8H2,(H,14,18)(H,15,16)/t9-,10-/m0/s1 |
| InChIKey | LEDGIUYBVZXZBM-UWVGGRQHSA-N |
| XLogP | -0.05 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |