C11H12NO2Y- — CID 164530225
3-[(2-methylbenzene-3-id-1-yl)methyl]-1,3-oxazolidin-2-one;yttrium (PubChem CID 164530225) has the molecular formula C11H12NO2Y- and a molecular weight of 279.13 g/mol. Its IUPAC name is 3-[(2-methylbenzene-3-id-1-yl)methyl]-1,3-oxazolidin-2-one;yttrium.
| Compound Name | 3-[(2-methylbenzene-3-id-1-yl)methyl]-1,3-oxazolidin-2-one;yttrium |
|---|---|
| PubChem CID | 164530225 |
| Molecular Formula | C11H12NO2Y- |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 3-[(2-methylbenzene-3-id-1-yl)methyl]-1,3-oxazolidin-2-one;yttrium |
| SMILES | Cc1[c-]cccc1CN1CCOC1=O.[Y] |
| InChI | InChI=1S/C11H12NO2.Y/c1-9-4-2-3-5-10(9)8-12-6-7-14-11(12)13;/h2-3,5H,6-8H2,1H3;/q-1; |
| InChIKey | AMNKSOCRPYIJGM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|