C27H39N2O4+ — CID 164531686
7-(diethylamino)-3-(2-methylpyridin-1-ium-4-yl)chromen-2-one;ethane;hexanoic acid (PubChem CID 164531686) has the molecular formula C27H39N2O4+ and a molecular weight of 455.62 g/mol. Its IUPAC name is 7-(diethylamino)-3-(2-methylpyridin-1-ium-4-yl)chromen-2-one;ethane;hexanoic acid.
| Compound Name | 7-(diethylamino)-3-(2-methylpyridin-1-ium-4-yl)chromen-2-one;ethane;hexanoic acid |
|---|---|
| PubChem CID | 164531686 |
| Molecular Formula | C27H39N2O4+ |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 7-(diethylamino)-3-(2-methylpyridin-1-ium-4-yl)chromen-2-one;ethane;hexanoic acid |
| SMILES | CC.CCCCCC(=O)O.CCN(CC)c1ccc2cc(-c3cc[nH+]c(C)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H20N2O2.C6H12O2.C2H6/c1-4-21(5-2)16-7-6-15-11-17(19(22)23-18(15)12-16)14-8-9-20-13(3)10-14;1-2-3-4-5-6(7)8;1-2/h6-12H,4-5H2,1-3H3;2-5H2,1H3,(H,7,8);1-2H3/p+1 |
| InChIKey | HSHGKCSRUMVJDY-UHFFFAOYSA-O |
| XLogP | 6.11 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|