C29H36N6O2 — CID 164533718
2-[4-[3-(diethylamino)propoxy]-3,5-dimethylanilino]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidine-5-carbonitrile (PubChem CID 164533718) has the molecular formula C29H36N6O2 and a molecular weight of 500.65 g/mol. Its IUPAC name is 2-[4-[3-(diethylamino)propoxy]-3,5-dimethylanilino]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidine-5-carbonitrile.
| Compound Name | 2-[4-[3-(diethylamino)propoxy]-3,5-dimethylanilino]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 164533718 |
| Molecular Formula | C29H36N6O2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 2-[4-[3-(diethylamino)propoxy]-3,5-dimethylanilino]-4-[(3S)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidine-5-carbonitrile |
| SMILES | CCN(CC)CCCOc1c(C)cc(Nc2ncc(C#N)c(N3OCC[C@H]3c3ccccc3)n2)cc1C |
| InChI | InChI=1S/C29H36N6O2/c1-5-34(6-2)14-10-15-36-27-21(3)17-25(18-22(27)4)32-29-31-20-24(19-30)28(33-29)35-26(13-16-37-35)23-11-8-7-9-12-23/h7-9,11-12,17-18,20,26H,5-6,10,13-16H2,1-4H3,(H,31,32,33)/t26-/m0/s1 |
| InChIKey | NODIZTDQZVIOKR-SANMLTNESA-N |
| XLogP | 5.70 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|