C25H40O4 — CID 164535963
2-[[(1R,3aR,9aS)-1-[(3S)-3-methyloctyl]-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-5-yl]oxy]acetic acid;ethane (PubChem CID 164535963) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is 2-[[(1R,3aR,9aS)-1-[(3S)-3-methyloctyl]-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-5-yl]oxy]acetic acid;ethane.
| Compound Name | 2-[[(1R,3aR,9aS)-1-[(3S)-3-methyloctyl]-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-5-yl]oxy]acetic acid;ethane |
|---|---|
| PubChem CID | 164535963 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 2-[[(1R,3aR,9aS)-1-[(3S)-3-methyloctyl]-1,3,3a,4,9,9a-hexahydrobenzo[f][2]benzofuran-5-yl]oxy]acetic acid;ethane |
| SMILES | CC.CCCCC[C@H](C)CC[C@H]1OC[C@@H]2Cc3c(cccc3OCC(=O)O)C[C@@H]21 |
| InChI | InChI=1S/C23H34O4.C2H6/c1-3-4-5-7-16(2)10-11-22-20-12-17-8-6-9-21(27-15-23(24)25)19(17)13-18(20)14-26-22;1-2/h6,8-9,16,18,20,22H,3-5,7,10-15H2,1-2H3,(H,24,25);1-2H3/t16-,18-,20-,22+;/m0./s1 |
| InChIKey | KRAHMXGPRULUPA-FYOSUFQFSA-N |
| XLogP | 5.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|