C24H23ClN4O6 — CID 164536007
5-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-2-methoxy-6-(1,3-oxazol-2-yl)pyridine-3-carboxamide (PubChem CID 164536007) has the molecular formula C24H23ClN4O6 and a molecular weight of 498.92 g/mol. Its IUPAC name is 5-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-2-methoxy-6-(1,3-oxazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 5-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-2-methoxy-6-(1,3-oxazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164536007 |
| Molecular Formula | C24H23ClN4O6 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 5-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-2-methoxy-6-(1,3-oxazol-2-yl)pyridine-3-carboxamide |
| SMILES | COc1nc(-c2ncco2)c(O[C@H]2CCN3C(=O)OC[C@@H]3C2)cc1C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClN4O6/c1-32-22-18(21(30)27-12-14-2-4-15(25)5-3-14)11-19(20(28-22)23-26-7-9-33-23)35-17-6-8-29-16(10-17)13-34-24(29)31/h2-5,7,9,11,16-17H,6,8,10,12-13H2,1H3,(H,27,30)/t16-,17-/m0/s1 |
| InChIKey | SSNKVJRZMMJGDW-IRXDYDNUSA-N |
| XLogP | 3.69 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |