C25H24ClN3O5S — CID 164536068
5-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-2-methoxy-6-thiophen-3-ylpyridine-3-carboxamide (PubChem CID 164536068) has the molecular formula C25H24ClN3O5S and a molecular weight of 514.00 g/mol. Its IUPAC name is 5-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-2-methoxy-6-thiophen-3-ylpyridine-3-carboxamide.
| Compound Name | 5-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-2-methoxy-6-thiophen-3-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 164536068 |
| Molecular Formula | C25H24ClN3O5S |
| Molecular Weight | 514.00 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 5-[[(7S,8aS)-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-7-yl]oxy]-N-[(4-chlorophenyl)methyl]-2-methoxy-6-thiophen-3-ylpyridine-3-carboxamide |
| SMILES | COc1nc(-c2ccsc2)c(O[C@H]2CCN3C(=O)OC[C@@H]3C2)cc1C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClN3O5S/c1-32-24-20(23(30)27-12-15-2-4-17(26)5-3-15)11-21(22(28-24)16-7-9-35-14-16)34-19-6-8-29-18(10-19)13-33-25(29)31/h2-5,7,9,11,14,18-19H,6,8,10,12-13H2,1H3,(H,27,30)/t18-,19-/m0/s1 |
| InChIKey | HAMVSGJWYMMJLV-OALUTQOASA-N |
| XLogP | 4.76 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.00 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |