About ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate
ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate (PubChem CID 164536312) has the molecular formula C10H16F2O3
and a molecular weight of 222.23 g/mol. Its IUPAC name is ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate |
| PubChem CID | 164536312 |
| Molecular Formula | C10H16F2O3 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate |
| SMILES | CCOC(=O)C1CC(F)(F)CC(C)(C)O1 |
| InChI | InChI=1S/C10H16F2O3/c1-4-14-8(13)7-5-10(11,12)6-9(2,3)15-7/h7H,4-6H2,1-3H3 |
| InChIKey | AIKPOPOKEXKQMF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate?
The IUPAC name of ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate (CID 164536312) is ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate.
What is the SMILES notation for ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate?
The canonical SMILES for ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate is CCOC(=O)C1CC(F)(F)CC(C)(C)O1.
What is the InChIKey of ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate?
The InChIKey is AIKPOPOKEXKQMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2O3/c1-4-14-8(13)7-5-10(11,12)6-9(2,3)15-7/h7H,4-6H2,1-3H3.
What are the key properties of ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate?
ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate has a molecular weight of 222.23 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4,4-difluoro-6,6-dimethyloxane-2-carboxylate is sourced from PubChem (CID 164536312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).