C23H25F6N5O2 — CID 164536644
1-ethyl-3-(1,1,1,5,5,5-hexafluoro-4-methylpentan-2-yl)-1-[[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]methyl]urea (PubChem CID 164536644) has the molecular formula C23H25F6N5O2 and a molecular weight of 517.47 g/mol. Its IUPAC name is 1-ethyl-3-(1,1,1,5,5,5-hexafluoro-4-methylpentan-2-yl)-1-[[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-(1,1,1,5,5,5-hexafluoro-4-methylpentan-2-yl)-1-[[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 164536644 |
| Molecular Formula | C23H25F6N5O2 |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 1-ethyl-3-(1,1,1,5,5,5-hexafluoro-4-methylpentan-2-yl)-1-[[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]methyl]urea |
| SMILES | CCN(Cc1cccc(-c2cn3ccnc3c(OC)n2)c1)C(=O)NC(CC(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H25F6N5O2/c1-4-33(21(35)32-18(23(27,28)29)10-14(2)22(24,25)26)12-15-6-5-7-16(11-15)17-13-34-9-8-30-19(34)20(31-17)36-3/h5-9,11,13-14,18H,4,10,12H2,1-3H3,(H,32,35) |
| InChIKey | NZHHMRYIWUIAPI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |