C23H21IN5O4P — CID 164538609
methyl (18E)-22-iodophosphanyl-5-methyl-8,11-dioxa-4,5,21,22,25-pentazapentacyclo[18.5.2.02,6.012,17.023,27]heptacosa-1(25),2(6),3,12(17),13,15,18,20,23,26-decaene-15-carboxylate (PubChem CID 164538609) has the molecular formula C23H21IN5O4P and a molecular weight of 589.33 g/mol. Its IUPAC name is methyl (18E)-22-iodophosphanyl-5-methyl-8,11-dioxa-4,5,21,22,25-pentazapentacyclo[18.5.2.02,6.012,17.023,27]heptacosa-1(25),2(6),3,12(17),13,15,18,20,23,26-decaene-15-carboxylate.
| Compound Name | methyl (18E)-22-iodophosphanyl-5-methyl-8,11-dioxa-4,5,21,22,25-pentazapentacyclo[18.5.2.02,6.012,17.023,27]heptacosa-1(25),2(6),3,12(17),13,15,18,20,23,26-decaene-15-carboxylate |
|---|---|
| PubChem CID | 164538609 |
| Molecular Formula | C23H21IN5O4P |
| Molecular Weight | 589.33 g/mol |
| Exact Mass | 589.04 |
| IUPAC Name | methyl (18E)-22-iodophosphanyl-5-methyl-8,11-dioxa-4,5,21,22,25-pentazapentacyclo[18.5.2.02,6.012,17.023,27]heptacosa-1(25),2(6),3,12(17),13,15,18,20,23,26-decaene-15-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)/C=C/c1nn(PI)c3cnc(cc13)-c1cnn(C)c1COCCO2 |
| InChI | InChI=1S/C23H21IN5O4P/c1-28-21-13-32-7-8-33-22-6-4-15(23(30)31-2)9-14(22)3-5-18-16-10-19(17(21)11-26-28)25-12-20(16)29(27-18)34-24/h3-6,9-12,34H,7-8,13H2,1-2H3/b5-3+ |
| InChIKey | FNWGCPUACVGPPW-HWKANZROSA-N |
| XLogP | 4.49 |
| TPSA | 93.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|