C9H20N2O — CID 164538993
N-(azetidin-3-yl)prop-2-enamide;molecular hydrogen;propane (PubChem CID 164538993) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is N-(azetidin-3-yl)prop-2-enamide;molecular hydrogen;propane.
| Compound Name | N-(azetidin-3-yl)prop-2-enamide;molecular hydrogen;propane |
|---|---|
| PubChem CID | 164538993 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N-(azetidin-3-yl)prop-2-enamide;molecular hydrogen;propane |
| SMILES | C=CC(=O)NC1CNC1.CCC.[H][H] |
| InChI | InChI=1S/C6H10N2O.C3H8.H2/c1-2-6(9)8-5-3-7-4-5;1-3-2;/h2,5,7H,1,3-4H2,(H,8,9);3H2,1-2H3;1H |
| InChIKey | SOTWIZVNCHCMKZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|