C16H25N2+ — CID 164539613
[4-[N-(cyclopropylmethyl)anilino]cyclohexyl]azanium (PubChem CID 164539613) has the molecular formula C16H25N2+ and a molecular weight of 245.39 g/mol. Its IUPAC name is [4-[N-(cyclopropylmethyl)anilino]cyclohexyl]azanium.
| Compound Name | [4-[N-(cyclopropylmethyl)anilino]cyclohexyl]azanium |
|---|---|
| PubChem CID | 164539613 |
| Molecular Formula | C16H25N2+ |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | [4-[N-(cyclopropylmethyl)anilino]cyclohexyl]azanium |
| SMILES | [NH3+]C1CCC(N(CC2CC2)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N2/c17-14-8-10-16(11-9-14)18(12-13-6-7-13)15-4-2-1-3-5-15/h1-5,13-14,16H,6-12,17H2/p+1 |
| InChIKey | LSBIHCOONOPGOP-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 30.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |