C24H31FN2O2 — CID 164539589
benzyl carbamate;N-cyclohexyl-N-(cyclopropylmethyl)-4-fluoroaniline (PubChem CID 164539589) has the molecular formula C24H31FN2O2 and a molecular weight of 398.52 g/mol. Its IUPAC name is benzyl carbamate;N-cyclohexyl-N-(cyclopropylmethyl)-4-fluoroaniline.
| Compound Name | benzyl carbamate;N-cyclohexyl-N-(cyclopropylmethyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 164539589 |
| Molecular Formula | C24H31FN2O2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | benzyl carbamate;N-cyclohexyl-N-(cyclopropylmethyl)-4-fluoroaniline |
| SMILES | Fc1ccc(N(CC2CC2)C2CCCCC2)cc1.NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H22FN.C8H9NO2/c17-14-8-10-16(11-9-14)18(12-13-6-7-13)15-4-2-1-3-5-15;9-8(10)11-6-7-4-2-1-3-5-7/h8-11,13,15H,1-7,12H2;1-5H,6H2,(H2,9,10) |
| InChIKey | KOECHBNOIZVEBO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |