C25H34N6O3 — CID 164543603
tert-butyl N-[(3S)-1-[[3-(2-iminobut-3-enoylamino)-5-(4-methylimidazol-1-yl)phenyl]methyl]piperidin-3-yl]carbamate (PubChem CID 164543603) has the molecular formula C25H34N6O3 and a molecular weight of 466.59 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[[3-(2-iminobut-3-enoylamino)-5-(4-methylimidazol-1-yl)phenyl]methyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[[3-(2-iminobut-3-enoylamino)-5-(4-methylimidazol-1-yl)phenyl]methyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 164543603 |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | tert-butyl N-[(3S)-1-[[3-(2-iminobut-3-enoylamino)-5-(4-methylimidazol-1-yl)phenyl]methyl]piperidin-3-yl]carbamate |
| SMILES | [H]/N=C(\C=C)C(=O)Nc1cc(CN2CCC[C@H](NC(=O)OC(C)(C)C)C2)cc(-n2cnc(C)c2)c1 |
| InChI | InChI=1S/C25H34N6O3/c1-6-22(26)23(32)28-20-10-18(11-21(12-20)31-13-17(2)27-16-31)14-30-9-7-8-19(15-30)29-24(33)34-25(3,4)5/h6,10-13,16,19,26H,1,7-9,14-15H2,2-5H3,(H,28,32)(H,29,33)/b26-22+/t19-/m0/s1 |
| InChIKey | YOOMZLKOZOFFRP-KYVIQDPYSA-N |
| XLogP | 3.81 |
| TPSA | 112.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|