C12H10ClFN2O — CID 164546065
2-amino-6-(5-chloro-2-fluorophenyl)-4-methylpyridin-3-ol (PubChem CID 164546065) has the molecular formula C12H10ClFN2O and a molecular weight of 252.68 g/mol. Its IUPAC name is 2-amino-6-(5-chloro-2-fluorophenyl)-4-methylpyridin-3-ol.
| Compound Name | 2-amino-6-(5-chloro-2-fluorophenyl)-4-methylpyridin-3-ol |
|---|---|
| PubChem CID | 164546065 |
| Molecular Formula | C12H10ClFN2O |
| Molecular Weight | 252.68 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-amino-6-(5-chloro-2-fluorophenyl)-4-methylpyridin-3-ol |
| SMILES | Cc1cc(-c2cc(Cl)ccc2F)nc(N)c1O |
| InChI | InChI=1S/C12H10ClFN2O/c1-6-4-10(16-12(15)11(6)17)8-5-7(13)2-3-9(8)14/h2-5,17H,1H3,(H2,15,16) |
| InChIKey | UFKLNOFWHMDUKE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |