C18H17ClF3N7O3 — CID 164549022
2-[1-[3-(6-chloro-3-imidazol-1-yl-5-methoxy-1-methylpyrrolo[3,2-b]pyridin-2-yl)-1H-1,2,4-triazol-5-yl]-2,2,2-trifluoroethoxy]ethanol (PubChem CID 164549022) has the molecular formula C18H17ClF3N7O3 and a molecular weight of 471.83 g/mol. Its IUPAC name is 2-[1-[3-(6-chloro-3-imidazol-1-yl-5-methoxy-1-methylpyrrolo[3,2-b]pyridin-2-yl)-1H-1,2,4-triazol-5-yl]-2,2,2-trifluoroethoxy]ethanol.
| Compound Name | 2-[1-[3-(6-chloro-3-imidazol-1-yl-5-methoxy-1-methylpyrrolo[3,2-b]pyridin-2-yl)-1H-1,2,4-triazol-5-yl]-2,2,2-trifluoroethoxy]ethanol |
|---|---|
| PubChem CID | 164549022 |
| Molecular Formula | C18H17ClF3N7O3 |
| Molecular Weight | 471.83 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-[1-[3-(6-chloro-3-imidazol-1-yl-5-methoxy-1-methylpyrrolo[3,2-b]pyridin-2-yl)-1H-1,2,4-triazol-5-yl]-2,2,2-trifluoroethoxy]ethanol |
| SMILES | COc1nc2c(-n3ccnc3)c(-c3n[nH]c(C(OCCO)C(F)(F)F)n3)n(C)c2cc1Cl |
| InChI | InChI=1S/C18H17ClF3N7O3/c1-28-10-7-9(19)17(31-2)24-11(10)12(29-4-3-23-8-29)13(28)15-25-16(27-26-15)14(18(20,21)22)32-6-5-30/h3-4,7-8,14,30H,5-6H2,1-2H3,(H,25,26,27) |
| InChIKey | DDKDQYWSWUXZOX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |