C16H13ClF3N7O2 — CID 164549041
1-[3-(6-chloro-3-imidazol-1-yl-5-methoxy-1-methylpyrrolo[3,2-b]pyridin-2-yl)-1H-1,2,4-triazol-5-yl]-2,2,2-trifluoroethanol (PubChem CID 164549041) has the molecular formula C16H13ClF3N7O2 and a molecular weight of 427.77 g/mol. Its IUPAC name is 1-[3-(6-chloro-3-imidazol-1-yl-5-methoxy-1-methylpyrrolo[3,2-b]pyridin-2-yl)-1H-1,2,4-triazol-5-yl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[3-(6-chloro-3-imidazol-1-yl-5-methoxy-1-methylpyrrolo[3,2-b]pyridin-2-yl)-1H-1,2,4-triazol-5-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 164549041 |
| Molecular Formula | C16H13ClF3N7O2 |
| Molecular Weight | 427.77 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 1-[3-(6-chloro-3-imidazol-1-yl-5-methoxy-1-methylpyrrolo[3,2-b]pyridin-2-yl)-1H-1,2,4-triazol-5-yl]-2,2,2-trifluoroethanol |
| SMILES | COc1nc2c(-n3ccnc3)c(-c3n[nH]c(C(O)C(F)(F)F)n3)n(C)c2cc1Cl |
| InChI | InChI=1S/C16H13ClF3N7O2/c1-26-8-5-7(17)15(29-2)22-9(8)10(27-4-3-21-6-27)11(26)13-23-14(25-24-13)12(28)16(18,19)20/h3-6,12,28H,1-2H3,(H,23,24,25) |
| InChIKey | JQJWTOGXIOWLJX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.77 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |