About CID 164549599
CID 164549599 (PubChem CID 164549599) has the molecular formula C26H28IN4O3-
and a molecular weight of 571.44 g/mol.
Molecular Properties
| Compound Name | CID 164549599 |
| PubChem CID | 164549599 |
| Molecular Formula | C26H28IN4O3- |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc(CC2CC[I-]C([C@H](O)c3ccccc3)N2)cc1)[C@@H]1CCc2nccc(=O)n21 |
| InChI | InChI=1S/C26H28IN4O3/c32-23-13-15-28-22-11-10-21(31(22)23)26(34)30-19-8-6-17(7-9-19)16-20-12-14-27-25(29-20)24(33)18-4-2-1-3-5-18/h1-9,13,15,20-21,24-25,29,33H,10-12,14,16H2,(H,30,34)/q-1/t20?,21-,24+,25?/m0/s1 |
| InChIKey | GWXXWLMAVBLPTL-KUKRUZIOSA-N |
| XLogP | -0.58 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 164549599 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164549599?
The IUPAC name of CID 164549599 (CID 164549599) is not available.
What is the SMILES notation for CID 164549599?
The canonical SMILES for CID 164549599 is O=C(Nc1ccc(CC2CC[I-]C([C@H](O)c3ccccc3)N2)cc1)[C@@H]1CCc2nccc(=O)n21.
What is the InChIKey of CID 164549599?
The InChIKey is GWXXWLMAVBLPTL-KUKRUZIOSA-N. The full InChI is InChI=1S/C26H28IN4O3/c32-23-13-15-28-22-11-10-21(31(22)23)26(34)30-19-8-6-17(7-9-19)16-20-12-14-27-25(29-20)24(33)18-4-2-1-3-5-18/h1-9,13,15,20-21,24-25,29,33H,10-12,14,16H2,(H,30,34)/q-1/t20?,21-,24+,25?/m0/s1.
What are the key properties of CID 164549599?
CID 164549599 has a molecular weight of 571.44 g/mol, XLogP of -0.58, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164549599 is sourced from PubChem (CID 164549599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).