C26H28IN4O3- — CID 164549599
CID 164549599 (PubChem CID 164549599) has the molecular formula C26H28IN4O3- and a molecular weight of 571.44 g/mol.
| Compound Name | CID 164549599 |
|---|---|
| PubChem CID | 164549599 |
| Molecular Formula | C26H28IN4O3- |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc(CC2CC[I-]C([C@H](O)c3ccccc3)N2)cc1)[C@@H]1CCc2nccc(=O)n21 |
| InChI | InChI=1S/C26H28IN4O3/c32-23-13-15-28-22-11-10-21(31(22)23)26(34)30-19-8-6-17(7-9-19)16-20-12-14-27-25(29-20)24(33)18-4-2-1-3-5-18/h1-9,13,15,20-21,24-25,29,33H,10-12,14,16H2,(H,30,34)/q-1/t20?,21-,24+,25?/m0/s1 |
| InChIKey | GWXXWLMAVBLPTL-KUKRUZIOSA-N |
| XLogP | -0.58 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|