About CID 164551635
CID 164551635 (PubChem CID 164551635) has the molecular formula C5H2BBrN2O2
and a molecular weight of 212.80 g/mol.
Molecular Properties
| Compound Name | CID 164551635 |
| PubChem CID | 164551635 |
| Molecular Formula | C5H2BBrN2O2 |
| Molecular Weight | 212.80 g/mol |
| Exact Mass | 211.94 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H2BBrN2O2/c6-3-2-8-5(7)1-4(3)9(10)11/h1-2H |
| InChIKey | BTUJFLWOTQXAHI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.80 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 164551635 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164551635?
The IUPAC name of CID 164551635 (CID 164551635) is not available.
What is the SMILES notation for CID 164551635?
The canonical SMILES for CID 164551635 is [B]c1cnc(Br)cc1[N+](=O)[O-].
What is the InChIKey of CID 164551635?
The InChIKey is BTUJFLWOTQXAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2BBrN2O2/c6-3-2-8-5(7)1-4(3)9(10)11/h1-2H.
What are the key properties of CID 164551635?
CID 164551635 has a molecular weight of 212.80 g/mol, XLogP of 0.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164551635 is sourced from PubChem (CID 164551635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).