About (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate
(6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate (PubChem CID 175311047) has the molecular formula C7H6BrN3O4
and a molecular weight of 276.05 g/mol. Its IUPAC name is (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate.
Molecular Properties
| Compound Name | (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate |
| PubChem CID | 175311047 |
| Molecular Formula | C7H6BrN3O4 |
| Molecular Weight | 276.05 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate |
| SMILES | NCC(=O)Oc1cnc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6BrN3O4/c8-6-1-4(11(13)14)5(3-10-6)15-7(12)2-9/h1,3H,2,9H2 |
| InChIKey | NZSIFNHGYCJTDC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.05 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate?
The IUPAC name of (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate (CID 175311047) is (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate.
What is the SMILES notation for (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate?
The canonical SMILES for (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate is NCC(=O)Oc1cnc(Br)cc1[N+](=O)[O-].
What is the InChIKey of (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate?
The InChIKey is NZSIFNHGYCJTDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3O4/c8-6-1-4(11(13)14)5(3-10-6)15-7(12)2-9/h1,3H,2,9H2.
What are the key properties of (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate?
(6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate has a molecular weight of 276.05 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-4-nitro-3-pyridinyl) 2-aminoacetate is sourced from PubChem (CID 175311047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).