About (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate
(4-amino-6-bromo-3-pyridinyl) 2-aminoacetate (PubChem CID 175311143) has the molecular formula C7H8BrN3O2
and a molecular weight of 246.06 g/mol. Its IUPAC name is (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate.
Molecular Properties
| Compound Name | (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate |
| PubChem CID | 175311143 |
| Molecular Formula | C7H8BrN3O2 |
| Molecular Weight | 246.06 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate |
| SMILES | NCC(=O)Oc1cnc(Br)cc1N |
| InChI | InChI=1S/C7H8BrN3O2/c8-6-1-4(10)5(3-11-6)13-7(12)2-9/h1,3H,2,9H2,(H2,10,11) |
| InChIKey | OPNSHFVCGJCCFZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.06 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate?
The IUPAC name of (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate (CID 175311143) is (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate.
What is the SMILES notation for (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate?
The canonical SMILES for (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate is NCC(=O)Oc1cnc(Br)cc1N.
What is the InChIKey of (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate?
The InChIKey is OPNSHFVCGJCCFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN3O2/c8-6-1-4(10)5(3-11-6)13-7(12)2-9/h1,3H,2,9H2,(H2,10,11).
What are the key properties of (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate?
(4-amino-6-bromo-3-pyridinyl) 2-aminoacetate has a molecular weight of 246.06 g/mol, XLogP of 0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-6-bromo-3-pyridinyl) 2-aminoacetate is sourced from PubChem (CID 175311143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).