C21H25N3 — CID 164553706
2-(2,6-dimethyl-4-pyridinyl)-3-methyl-6-piperidin-3-yl-1H-indole (PubChem CID 164553706) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-pyridinyl)-3-methyl-6-piperidin-3-yl-1H-indole.
| Compound Name | 2-(2,6-dimethyl-4-pyridinyl)-3-methyl-6-piperidin-3-yl-1H-indole |
|---|---|
| PubChem CID | 164553706 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-(2,6-dimethyl-4-pyridinyl)-3-methyl-6-piperidin-3-yl-1H-indole |
| SMILES | Cc1cc(-c2[nH]c3cc(C4CCCNC4)ccc3c2C)cc(C)n1 |
| InChI | InChI=1S/C21H25N3/c1-13-9-18(10-14(2)23-13)21-15(3)19-7-6-16(11-20(19)24-21)17-5-4-8-22-12-17/h6-7,9-11,17,22,24H,4-5,8,12H2,1-3H3 |
| InChIKey | BAHKBUXFNMEODT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |