C14H30N2O2 — CID 164556104
ethane;3-(2-hydroxypropan-2-yl)-N-(2-methylpropyl)pyrrolidine-1-carboxamide (PubChem CID 164556104) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is ethane;3-(2-hydroxypropan-2-yl)-N-(2-methylpropyl)pyrrolidine-1-carboxamide.
| Compound Name | ethane;3-(2-hydroxypropan-2-yl)-N-(2-methylpropyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 164556104 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | ethane;3-(2-hydroxypropan-2-yl)-N-(2-methylpropyl)pyrrolidine-1-carboxamide |
| SMILES | CC.CC(C)CNC(=O)N1CCC(C(C)(C)O)C1 |
| InChI | InChI=1S/C12H24N2O2.C2H6/c1-9(2)7-13-11(15)14-6-5-10(8-14)12(3,4)16;1-2/h9-10,16H,5-8H2,1-4H3,(H,13,15);1-2H3 |
| InChIKey | APBSMAOKVJFROZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |