C12H22F3N3O — CID 165487439
4-amino-N-(2-methylpropyl)-5-(trifluoromethyl)azepane-1-carboxamide (PubChem CID 165487439) has the molecular formula C12H22F3N3O and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-amino-N-(2-methylpropyl)-5-(trifluoromethyl)azepane-1-carboxamide.
| Compound Name | 4-amino-N-(2-methylpropyl)-5-(trifluoromethyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 165487439 |
| Molecular Formula | C12H22F3N3O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-amino-N-(2-methylpropyl)-5-(trifluoromethyl)azepane-1-carboxamide |
| SMILES | CC(C)CNC(=O)N1CCC(N)C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3N3O/c1-8(2)7-17-11(19)18-5-3-9(12(13,14)15)10(16)4-6-18/h8-10H,3-7,16H2,1-2H3,(H,17,19) |
| InChIKey | JHXFMZSWXBIADC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |