C16H28F3N3O5S — CID 155840537
(4aS,9aR)-4-methyl-N-(2-methylpropyl)-1,1-dioxo-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155840537) has the molecular formula C16H28F3N3O5S and a molecular weight of 431.48 g/mol. Its IUPAC name is (4aS,9aR)-4-methyl-N-(2-methylpropyl)-1,1-dioxo-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,9aR)-4-methyl-N-(2-methylpropyl)-1,1-dioxo-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155840537 |
| Molecular Formula | C16H28F3N3O5S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (4aS,9aR)-4-methyl-N-(2-methylpropyl)-1,1-dioxo-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CNC(=O)N1CC[C@@H]2[C@H](CC1)N(C)CCS2(=O)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H27N3O3S.C2HF3O2/c1-11(2)10-15-14(18)17-6-4-12-13(5-7-17)21(19,20)9-8-16(12)3;3-2(4,5)1(6)7/h11-13H,4-10H2,1-3H3,(H,15,18);(H,6,7)/t12-,13+;/m0./s1 |
| InChIKey | BBYODISYRVLMEX-JHEYCYPBSA-N |
| XLogP | 1.18 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |