C17H28F3N3O5S — CID 155826206
(4aS,9aR)-N-cyclopentyl-4-methyl-1,1-dioxo-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826206) has the molecular formula C17H28F3N3O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is (4aS,9aR)-N-cyclopentyl-4-methyl-1,1-dioxo-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,9aR)-N-cyclopentyl-4-methyl-1,1-dioxo-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826206 |
| Molecular Formula | C17H28F3N3O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (4aS,9aR)-N-cyclopentyl-4-methyl-1,1-dioxo-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCS(=O)(=O)[C@@H]2CCN(C(=O)NC3CCCC3)CC[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H27N3O3S.C2HF3O2/c1-17-10-11-22(20,21)14-7-9-18(8-6-13(14)17)15(19)16-12-4-2-3-5-12;3-2(4,5)1(6)7/h12-14H,2-11H2,1H3,(H,16,19);(H,6,7)/t13-,14+;/m0./s1 |
| InChIKey | ZCOJEONRFWGLBF-LMRHVHIWSA-N |
| XLogP | 1.47 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |