C17H38N2O — CID 164557293
N'-ethyl-N-methyl-N-[2-(4-methylpentoxy)ethyl]-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 164557293) has the molecular formula C17H38N2O and a molecular weight of 286.50 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N-[2-(4-methylpentoxy)ethyl]-N'-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N-methyl-N-[2-(4-methylpentoxy)ethyl]-N'-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 164557293 |
| Molecular Formula | C17H38N2O |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.30 |
| IUPAC Name | N'-ethyl-N-methyl-N-[2-(4-methylpentoxy)ethyl]-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CCN(CCN(C)CCOCCCC(C)C)CC(C)C |
| InChI | InChI=1S/C17H38N2O/c1-7-19(15-17(4)5)11-10-18(6)12-14-20-13-8-9-16(2)3/h16-17H,7-15H2,1-6H3 |
| InChIKey | JSMXTVWHTJXRLZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|