C12H9F3N4 — CID 164557635
N-[4-methyl-6-[4-(trifluoromethyl)-3-pyridinyl]pyridazin-3-yl]methanimine (PubChem CID 164557635) has the molecular formula C12H9F3N4 and a molecular weight of 266.23 g/mol. Its IUPAC name is N-[4-methyl-6-[4-(trifluoromethyl)-3-pyridinyl]pyridazin-3-yl]methanimine.
| Compound Name | N-[4-methyl-6-[4-(trifluoromethyl)-3-pyridinyl]pyridazin-3-yl]methanimine |
|---|---|
| PubChem CID | 164557635 |
| Molecular Formula | C12H9F3N4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-[4-methyl-6-[4-(trifluoromethyl)-3-pyridinyl]pyridazin-3-yl]methanimine |
| SMILES | C=Nc1nnc(-c2cnccc2C(F)(F)F)cc1C |
| InChI | InChI=1S/C12H9F3N4/c1-7-5-10(18-19-11(7)16-2)8-6-17-4-3-9(8)12(13,14)15/h3-6H,2H2,1H3 |
| InChIKey | QFQMXAVIZWQLFR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|